C17H21N5O4S3 — CID 16517878
N-(4-morpholin-4-ylsulfonylphenyl)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide (PubChem CID 16517878) has the molecular formula C17H21N5O4S3 and a molecular weight of 455.59 g/mol. Its IUPAC name is N-(4-morpholin-4-ylsulfonylphenyl)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-(4-morpholin-4-ylsulfonylphenyl)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 16517878 |
| Molecular Formula | C17H21N5O4S3 |
| Molecular Weight | 455.59 g/mol |
| Exact Mass | 455.08 |
| IUPAC Name | N-(4-morpholin-4-ylsulfonylphenyl)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
| SMILES | C=CCNc1nnc(SCC(=O)Nc2ccc(S(=O)(=O)N3CCOCC3)cc2)s1 |
| InChI | InChI=1S/C17H21N5O4S3/c1-2-7-18-16-20-21-17(28-16)27-12-15(23)19-13-3-5-14(6-4-13)29(24,25)22-8-10-26-11-9-22/h2-6H,1,7-12H2,(H,18,20)(H,19,23) |
| InChIKey | PBJGOKGQDYFEAH-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.59 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|