C17H20ClN5O4S3 — CID 16517907
N-(4-chloro-3-morpholin-4-ylsulfonylphenyl)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide (PubChem CID 16517907) has the molecular formula C17H20ClN5O4S3 and a molecular weight of 490.03 g/mol. Its IUPAC name is N-(4-chloro-3-morpholin-4-ylsulfonylphenyl)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-(4-chloro-3-morpholin-4-ylsulfonylphenyl)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 16517907 |
| Molecular Formula | C17H20ClN5O4S3 |
| Molecular Weight | 490.03 g/mol |
| Exact Mass | 489.04 |
| IUPAC Name | N-(4-chloro-3-morpholin-4-ylsulfonylphenyl)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
| SMILES | C=CCNc1nnc(SCC(=O)Nc2ccc(Cl)c(S(=O)(=O)N3CCOCC3)c2)s1 |
| InChI | InChI=1S/C17H20ClN5O4S3/c1-2-5-19-16-21-22-17(29-16)28-11-15(24)20-12-3-4-13(18)14(10-12)30(25,26)23-6-8-27-9-7-23/h2-4,10H,1,5-9,11H2,(H,19,21)(H,20,24) |
| InChIKey | KEHAYAGWEJDWKU-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.03 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|