C16H20N4O3S3 — CID 7798243
5-[(3-morpholin-4-ylsulfonylphenyl)methylsulfanyl]-N-prop-2-enyl-1,3,4-thiadiazol-2-amine (PubChem CID 7798243) has the molecular formula C16H20N4O3S3 and a molecular weight of 412.56 g/mol. Its IUPAC name is 5-[(3-morpholin-4-ylsulfonylphenyl)methylsulfanyl]-N-prop-2-enyl-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[(3-morpholin-4-ylsulfonylphenyl)methylsulfanyl]-N-prop-2-enyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 7798243 |
| Molecular Formula | C16H20N4O3S3 |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | 5-[(3-morpholin-4-ylsulfonylphenyl)methylsulfanyl]-N-prop-2-enyl-1,3,4-thiadiazol-2-amine |
| SMILES | C=CCNc1nnc(SCc2cccc(S(=O)(=O)N3CCOCC3)c2)s1 |
| InChI | InChI=1S/C16H20N4O3S3/c1-2-6-17-15-18-19-16(25-15)24-12-13-4-3-5-14(11-13)26(21,22)20-7-9-23-10-8-20/h2-5,11H,1,6-10,12H2,(H,17,18) |
| InChIKey | LEIFBRUNNMILQD-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|