C22H25N5O2S3 — CID 16605562
5-[[5-(4-benzylpiperidin-1-yl)sulfonyl-2-pyridinyl]sulfanyl]-N-prop-2-enyl-1,3,4-thiadiazol-2-amine (PubChem CID 16605562) has the molecular formula C22H25N5O2S3 and a molecular weight of 487.68 g/mol. Its IUPAC name is 5-[[5-(4-benzylpiperidin-1-yl)sulfonyl-2-pyridinyl]sulfanyl]-N-prop-2-enyl-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[[5-(4-benzylpiperidin-1-yl)sulfonyl-2-pyridinyl]sulfanyl]-N-prop-2-enyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 16605562 |
| Molecular Formula | C22H25N5O2S3 |
| Molecular Weight | 487.68 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | 5-[[5-(4-benzylpiperidin-1-yl)sulfonyl-2-pyridinyl]sulfanyl]-N-prop-2-enyl-1,3,4-thiadiazol-2-amine |
| SMILES | C=CCNc1nnc(Sc2ccc(S(=O)(=O)N3CCC(Cc4ccccc4)CC3)cn2)s1 |
| InChI | InChI=1S/C22H25N5O2S3/c1-2-12-23-21-25-26-22(31-21)30-20-9-8-19(16-24-20)32(28,29)27-13-10-18(11-14-27)15-17-6-4-3-5-7-17/h2-9,16,18H,1,10-15H2,(H,23,25) |
| InChIKey | MHYQJSUEKAVGTK-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.68 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|