C16H18N4OS2 — CID 8603173
(2S)-N-cyclopropyl-2-phenyl-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide (PubChem CID 8603173) has the molecular formula C16H18N4OS2 and a molecular weight of 346.48 g/mol. Its IUPAC name is (2S)-N-cyclopropyl-2-phenyl-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | (2S)-N-cyclopropyl-2-phenyl-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 8603173 |
| Molecular Formula | C16H18N4OS2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | (2S)-N-cyclopropyl-2-phenyl-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
| SMILES | C=CCNc1nnc(S[C@H](C(=O)NC2CC2)c2ccccc2)s1 |
| InChI | InChI=1S/C16H18N4OS2/c1-2-10-17-15-19-20-16(23-15)22-13(11-6-4-3-5-7-11)14(21)18-12-8-9-12/h2-7,12-13H,1,8-10H2,(H,17,19)(H,18,21)/t13-/m0/s1 |
| InChIKey | HZFZETJGSDNXRH-ZDUSSCGKSA-N |
| XLogP | 3.25 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|