C21H22N4OS2 — CID 7797123
(2S)-N-(2,5-dimethylphenyl)-2-phenyl-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide (PubChem CID 7797123) has the molecular formula C21H22N4OS2 and a molecular weight of 410.57 g/mol. Its IUPAC name is (2S)-N-(2,5-dimethylphenyl)-2-phenyl-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | (2S)-N-(2,5-dimethylphenyl)-2-phenyl-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 7797123 |
| Molecular Formula | C21H22N4OS2 |
| Molecular Weight | 410.57 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | (2S)-N-(2,5-dimethylphenyl)-2-phenyl-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
| SMILES | C=CCNc1nnc(S[C@H](C(=O)Nc2cc(C)ccc2C)c2ccccc2)s1 |
| InChI | InChI=1S/C21H22N4OS2/c1-4-12-22-20-24-25-21(28-20)27-18(16-8-6-5-7-9-16)19(26)23-17-13-14(2)10-11-15(17)3/h4-11,13,18H,1,12H2,2-3H3,(H,22,24)(H,23,26)/t18-/m0/s1 |
| InChIKey | KHQNUMTYSXVGEX-SFHVURJKSA-N |
| XLogP | 5.22 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.57 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|