C16H19N5O2S2 — CID 7798366
(2S)-N-(ethylcarbamoyl)-2-phenyl-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide (PubChem CID 7798366) has the molecular formula C16H19N5O2S2 and a molecular weight of 377.50 g/mol. Its IUPAC name is (2S)-N-(ethylcarbamoyl)-2-phenyl-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | (2S)-N-(ethylcarbamoyl)-2-phenyl-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 7798366 |
| Molecular Formula | C16H19N5O2S2 |
| Molecular Weight | 377.50 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | (2S)-N-(ethylcarbamoyl)-2-phenyl-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
| SMILES | C=CCNc1nnc(S[C@H](C(=O)NC(=O)NCC)c2ccccc2)s1 |
| InChI | InChI=1S/C16H19N5O2S2/c1-3-10-18-15-20-21-16(25-15)24-12(11-8-6-5-7-9-11)13(22)19-14(23)17-4-2/h3,5-9,12H,1,4,10H2,2H3,(H,18,20)(H2,17,19,22,23)/t12-/m0/s1 |
| InChIKey | DDJVGZPZAGKZQH-LBPRGKRZSA-N |
| XLogP | 2.82 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.50 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|