C18H24N4OS2 — CID 7797841
(2S)-N-[2-[(2R)-butan-2-yl]phenyl]-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide (PubChem CID 7797841) has the molecular formula C18H24N4OS2 and a molecular weight of 376.55 g/mol. Its IUPAC name is (2S)-N-[2-[(2R)-butan-2-yl]phenyl]-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide.
| Compound Name | (2S)-N-[2-[(2R)-butan-2-yl]phenyl]-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 7797841 |
| Molecular Formula | C18H24N4OS2 |
| Molecular Weight | 376.55 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | (2S)-N-[2-[(2R)-butan-2-yl]phenyl]-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide |
| SMILES | C=CCNc1nnc(S[C@@H](C)C(=O)Nc2ccccc2[C@H](C)CC)s1 |
| InChI | InChI=1S/C18H24N4OS2/c1-5-11-19-17-21-22-18(25-17)24-13(4)16(23)20-15-10-8-7-9-14(15)12(3)6-2/h5,7-10,12-13H,1,6,11H2,2-4H3,(H,19,21)(H,20,23)/t12-,13+/m1/s1 |
| InChIKey | WFRRCZCLVIXITE-OLZOCXBDSA-N |
| XLogP | 4.77 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.55 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|