C15H15F3N4O2S2 — CID 9487495
(2R)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[4-(trifluoromethoxy)phenyl]propanamide (PubChem CID 9487495) has the molecular formula C15H15F3N4O2S2 and a molecular weight of 404.44 g/mol. Its IUPAC name is (2R)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[4-(trifluoromethoxy)phenyl]propanamide.
| Compound Name | (2R)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[4-(trifluoromethoxy)phenyl]propanamide |
|---|---|
| PubChem CID | 9487495 |
| Molecular Formula | C15H15F3N4O2S2 |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | (2R)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[4-(trifluoromethoxy)phenyl]propanamide |
| SMILES | C=CCNc1nnc(S[C@H](C)C(=O)Nc2ccc(OC(F)(F)F)cc2)s1 |
| InChI | InChI=1S/C15H15F3N4O2S2/c1-3-8-19-13-21-22-14(26-13)25-9(2)12(23)20-10-4-6-11(7-5-10)24-15(16,17)18/h3-7,9H,1,8H2,2H3,(H,19,21)(H,20,23)/t9-/m1/s1 |
| InChIKey | ZACFYYPZTNYRTN-SECBINFHSA-N |
| XLogP | 4.15 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|