C14H14ClFN4OS2 — CID 55421806
N-(3-chloro-4-fluorophenyl)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide (PubChem CID 55421806) has the molecular formula C14H14ClFN4OS2 and a molecular weight of 372.88 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 55421806 |
| Molecular Formula | C14H14ClFN4OS2 |
| Molecular Weight | 372.88 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide |
| SMILES | C=CCNc1nnc(SC(C)C(=O)Nc2ccc(F)c(Cl)c2)s1 |
| InChI | InChI=1S/C14H14ClFN4OS2/c1-3-6-17-13-19-20-14(23-13)22-8(2)12(21)18-9-4-5-11(16)10(15)7-9/h3-5,7-8H,1,6H2,2H3,(H,17,19)(H,18,21) |
| InChIKey | JJDQVQQPDDDGEA-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.88 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|