C13H13Cl2N5OS2 — CID 7797598
(2S)-N-(3,5-dichloro-2-pyridinyl)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide (PubChem CID 7797598) has the molecular formula C13H13Cl2N5OS2 and a molecular weight of 390.32 g/mol. Its IUPAC name is (2S)-N-(3,5-dichloro-2-pyridinyl)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide.
| Compound Name | (2S)-N-(3,5-dichloro-2-pyridinyl)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 7797598 |
| Molecular Formula | C13H13Cl2N5OS2 |
| Molecular Weight | 390.32 g/mol |
| Exact Mass | 388.99 |
| IUPAC Name | (2S)-N-(3,5-dichloro-2-pyridinyl)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide |
| SMILES | C=CCNc1nnc(S[C@@H](C)C(=O)Nc2ncc(Cl)cc2Cl)s1 |
| InChI | InChI=1S/C13H13Cl2N5OS2/c1-3-4-16-12-19-20-13(23-12)22-7(2)11(21)18-10-9(15)5-8(14)6-17-10/h3,5-7H,1,4H2,2H3,(H,16,19)(H,17,18,21)/t7-/m0/s1 |
| InChIKey | GHCBDFDDIFRGSG-ZETCQYMHSA-N |
| XLogP | 3.96 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.32 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|