C14H13F3N4OS2 — CID 7797819
(2S)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2,3,4-trifluorophenyl)propanamide (PubChem CID 7797819) has the molecular formula C14H13F3N4OS2 and a molecular weight of 374.41 g/mol. Its IUPAC name is (2S)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2,3,4-trifluorophenyl)propanamide.
| Compound Name | (2S)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2,3,4-trifluorophenyl)propanamide |
|---|---|
| PubChem CID | 7797819 |
| Molecular Formula | C14H13F3N4OS2 |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | (2S)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2,3,4-trifluorophenyl)propanamide |
| SMILES | C=CCNc1nnc(S[C@@H](C)C(=O)Nc2ccc(F)c(F)c2F)s1 |
| InChI | InChI=1S/C14H13F3N4OS2/c1-3-6-18-13-20-21-14(24-13)23-7(2)12(22)19-9-5-4-8(15)10(16)11(9)17/h3-5,7H,1,6H2,2H3,(H,18,20)(H,19,22)/t7-/m0/s1 |
| InChIKey | JXDWIJFKYIMGKO-ZETCQYMHSA-N |
| XLogP | 3.67 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|