C15H17FN4OS2 — CID 51236049
N-[(4-fluorophenyl)methyl]-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide (PubChem CID 51236049) has the molecular formula C15H17FN4OS2 and a molecular weight of 352.46 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 51236049 |
| Molecular Formula | C15H17FN4OS2 |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide |
| SMILES | C=CCNc1nnc(SC(C)C(=O)NCc2ccc(F)cc2)s1 |
| InChI | InChI=1S/C15H17FN4OS2/c1-3-8-17-14-19-20-15(23-14)22-10(2)13(21)18-9-11-4-6-12(16)7-5-11/h3-7,10H,1,8-9H2,2H3,(H,17,19)(H,18,21) |
| InChIKey | AENUVXYYKHQORY-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|