C15H17N5O2S2 — CID 8956974
N'-[(2R)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanoyl]benzohydrazide (PubChem CID 8956974) has the molecular formula C15H17N5O2S2 and a molecular weight of 363.47 g/mol. Its IUPAC name is N'-[(2R)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanoyl]benzohydrazide.
| Compound Name | N'-[(2R)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanoyl]benzohydrazide |
|---|---|
| PubChem CID | 8956974 |
| Molecular Formula | C15H17N5O2S2 |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | N'-[(2R)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanoyl]benzohydrazide |
| SMILES | C=CCNc1nnc(S[C@H](C)C(=O)NNC(=O)c2ccccc2)s1 |
| InChI | InChI=1S/C15H17N5O2S2/c1-3-9-16-14-19-20-15(24-14)23-10(2)12(21)17-18-13(22)11-7-5-4-6-8-11/h3-8,10H,1,9H2,2H3,(H,16,19)(H,17,21)(H,18,22)/t10-/m1/s1 |
| InChIKey | PHTGLCKJUDSGAI-SNVBAGLBSA-N |
| XLogP | 2.08 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|