C8H12N4OS2 — CID 7797762
(2S)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide (PubChem CID 7797762) has the molecular formula C8H12N4OS2 and a molecular weight of 244.34 g/mol. Its IUPAC name is (2S)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide.
| Compound Name | (2S)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 7797762 |
| Molecular Formula | C8H12N4OS2 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | (2S)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanamide |
| SMILES | C=CCNc1nnc(S[C@@H](C)C(N)=O)s1 |
| InChI | InChI=1S/C8H12N4OS2/c1-3-4-10-7-11-12-8(15-7)14-5(2)6(9)13/h3,5H,1,4H2,2H3,(H2,9,13)(H,10,11)/t5-/m0/s1 |
| InChIKey | BDDXGOOBUZKCTK-YFKPBYRVSA-N |
| XLogP | 1.10 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|