C12H18N4OS2 — CID 42897337
2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-1-pyrrolidin-1-ylpropan-1-one (PubChem CID 42897337) has the molecular formula C12H18N4OS2 and a molecular weight of 298.44 g/mol. Its IUPAC name is 2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-1-pyrrolidin-1-ylpropan-1-one.
| Compound Name | 2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-1-pyrrolidin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 42897337 |
| Molecular Formula | C12H18N4OS2 |
| Molecular Weight | 298.44 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-1-pyrrolidin-1-ylpropan-1-one |
| SMILES | C=CCNc1nnc(SC(C)C(=O)N2CCCC2)s1 |
| InChI | InChI=1S/C12H18N4OS2/c1-3-6-13-11-14-15-12(19-11)18-9(2)10(17)16-7-4-5-8-16/h3,9H,1,4-8H2,2H3,(H,13,14) |
| InChIKey | JAFBAXAMVALFBL-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.44 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|