C16H17N5O2S2 — CID 42897190
4-[2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanoyl]-1,3-dihydroquinoxalin-2-one (PubChem CID 42897190) has the molecular formula C16H17N5O2S2 and a molecular weight of 375.48 g/mol. Its IUPAC name is 4-[2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanoyl]-1,3-dihydroquinoxalin-2-one.
| Compound Name | 4-[2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanoyl]-1,3-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 42897190 |
| Molecular Formula | C16H17N5O2S2 |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | 4-[2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]propanoyl]-1,3-dihydroquinoxalin-2-one |
| SMILES | C=CCNc1nnc(SC(C)C(=O)N2CC(=O)Nc3ccccc32)s1 |
| InChI | InChI=1S/C16H17N5O2S2/c1-3-8-17-15-19-20-16(25-15)24-10(2)14(23)21-9-13(22)18-11-6-4-5-7-12(11)21/h3-7,10H,1,8-9H2,2H3,(H,17,19)(H,18,22) |
| InChIKey | HMHLAOYUUOXYFZ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|