C22H20FN5O2S — CID 112797656
4-[2-[[5-(2-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanoyl]-1,3-dihydroquinoxalin-2-one (PubChem CID 112797656) has the molecular formula C22H20FN5O2S and a molecular weight of 437.50 g/mol. Its IUPAC name is 4-[2-[[5-(2-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanoyl]-1,3-dihydroquinoxalin-2-one.
| Compound Name | 4-[2-[[5-(2-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanoyl]-1,3-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 112797656 |
| Molecular Formula | C22H20FN5O2S |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | 4-[2-[[5-(2-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanoyl]-1,3-dihydroquinoxalin-2-one |
| SMILES | C=CCn1c(SC(C)C(=O)N2CC(=O)Nc3ccccc32)nnc1-c1ccccc1F |
| InChI | InChI=1S/C22H20FN5O2S/c1-3-12-27-20(15-8-4-5-9-16(15)23)25-26-22(27)31-14(2)21(30)28-13-19(29)24-17-10-6-7-11-18(17)28/h3-11,14H,1,12-13H2,2H3,(H,24,29) |
| InChIKey | WAQPXUWHPQDZCD-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|