C21H27FN4OS — CID 112784555
N-(cyclohexylmethyl)-2-[[5-(2-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanamide (PubChem CID 112784555) has the molecular formula C21H27FN4OS and a molecular weight of 402.54 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-2-[[5-(2-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanamide.
| Compound Name | N-(cyclohexylmethyl)-2-[[5-(2-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 112784555 |
| Molecular Formula | C21H27FN4OS |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | N-(cyclohexylmethyl)-2-[[5-(2-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanamide |
| SMILES | C=CCn1c(SC(C)C(=O)NCC2CCCCC2)nnc1-c1ccccc1F |
| InChI | InChI=1S/C21H27FN4OS/c1-3-13-26-19(17-11-7-8-12-18(17)22)24-25-21(26)28-15(2)20(27)23-14-16-9-5-4-6-10-16/h3,7-8,11-12,15-16H,1,4-6,9-10,13-14H2,2H3,(H,23,27) |
| InChIKey | MKBSEGOBKNOTGM-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|