C22H30N4O2S — CID 7869885
(2R)-2-[[5-(2-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(1R,2R)-2-methylcyclohexyl]propanamide (PubChem CID 7869885) has the molecular formula C22H30N4O2S and a molecular weight of 414.58 g/mol. Its IUPAC name is (2R)-2-[[5-(2-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(1R,2R)-2-methylcyclohexyl]propanamide.
| Compound Name | (2R)-2-[[5-(2-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(1R,2R)-2-methylcyclohexyl]propanamide |
|---|---|
| PubChem CID | 7869885 |
| Molecular Formula | C22H30N4O2S |
| Molecular Weight | 414.58 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | (2R)-2-[[5-(2-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(1R,2R)-2-methylcyclohexyl]propanamide |
| SMILES | C=CCn1c(S[C@H](C)C(=O)N[C@@H]2CCCC[C@H]2C)nnc1-c1ccccc1OC |
| InChI | InChI=1S/C22H30N4O2S/c1-5-14-26-20(17-11-7-9-13-19(17)28-4)24-25-22(26)29-16(3)21(27)23-18-12-8-6-10-15(18)2/h5,7,9,11,13,15-16,18H,1,6,8,10,12,14H2,2-4H3,(H,23,27)/t15-,16-,18-/m1/s1 |
| InChIKey | UFKZKQZGQDGCGN-JFIYKMOQSA-N |
| XLogP | 4.32 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.58 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|