C18H23N5O3S — CID 7869874
(2R)-N-carbamoyl-2-[[5-(2-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-3-methylbutanamide (PubChem CID 7869874) has the molecular formula C18H23N5O3S and a molecular weight of 389.48 g/mol. Its IUPAC name is (2R)-N-carbamoyl-2-[[5-(2-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-3-methylbutanamide.
| Compound Name | (2R)-N-carbamoyl-2-[[5-(2-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 7869874 |
| Molecular Formula | C18H23N5O3S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | (2R)-N-carbamoyl-2-[[5-(2-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-3-methylbutanamide |
| SMILES | C=CCn1c(S[C@@H](C(=O)NC(N)=O)C(C)C)nnc1-c1ccccc1OC |
| InChI | InChI=1S/C18H23N5O3S/c1-5-10-23-15(12-8-6-7-9-13(12)26-4)21-22-18(23)27-14(11(2)3)16(24)20-17(19)25/h5-9,11,14H,1,10H2,2-4H3,(H3,19,20,24,25)/t14-/m1/s1 |
| InChIKey | FUOOAACDXZHELT-CQSZACIVSA-N |
| XLogP | 2.45 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|