C21H27ClN4OS — CID 7869634
(2R)-2-[[5-(4-chlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(1S,2S)-2-methylcyclohexyl]propanamide (PubChem CID 7869634) has the molecular formula C21H27ClN4OS and a molecular weight of 418.99 g/mol. Its IUPAC name is (2R)-2-[[5-(4-chlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(1S,2S)-2-methylcyclohexyl]propanamide.
| Compound Name | (2R)-2-[[5-(4-chlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(1S,2S)-2-methylcyclohexyl]propanamide |
|---|---|
| PubChem CID | 7869634 |
| Molecular Formula | C21H27ClN4OS |
| Molecular Weight | 418.99 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | (2R)-2-[[5-(4-chlorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(1S,2S)-2-methylcyclohexyl]propanamide |
| SMILES | C=CCn1c(S[C@H](C)C(=O)N[C@H]2CCCC[C@@H]2C)nnc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H27ClN4OS/c1-4-13-26-19(16-9-11-17(22)12-10-16)24-25-21(26)28-15(3)20(27)23-18-8-6-5-7-14(18)2/h4,9-12,14-15,18H,1,5-8,13H2,2-3H3,(H,23,27)/t14-,15+,18-/m0/s1 |
| InChIKey | LHWWMESODFGKGN-DAYGRLMNSA-N |
| XLogP | 4.96 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.99 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|