C19H25N5OS — CID 40744742
(2S)-N-cyclohexyl-2-[(4-prop-2-enyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]propanamide (PubChem CID 40744742) has the molecular formula C19H25N5OS and a molecular weight of 371.51 g/mol. Its IUPAC name is (2S)-N-cyclohexyl-2-[(4-prop-2-enyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]propanamide.
| Compound Name | (2S)-N-cyclohexyl-2-[(4-prop-2-enyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 40744742 |
| Molecular Formula | C19H25N5OS |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | (2S)-N-cyclohexyl-2-[(4-prop-2-enyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]propanamide |
| SMILES | C=CCn1c(S[C@@H](C)C(=O)NC2CCCCC2)nnc1-c1ccncc1 |
| InChI | InChI=1S/C19H25N5OS/c1-3-13-24-17(15-9-11-20-12-10-15)22-23-19(24)26-14(2)18(25)21-16-7-5-4-6-8-16/h3,9-12,14,16H,1,4-8,13H2,2H3,(H,21,25)/t14-/m0/s1 |
| InChIKey | UDNFQRABBIWENI-AWEZNQCLSA-N |
| XLogP | 3.46 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|