C18H29N5OS — CID 126438872
(2S)-N-cyclopentyl-2-[(5-piperidin-4-yl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propanamide (PubChem CID 126438872) has the molecular formula C18H29N5OS and a molecular weight of 363.53 g/mol. Its IUPAC name is (2S)-N-cyclopentyl-2-[(5-piperidin-4-yl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propanamide.
| Compound Name | (2S)-N-cyclopentyl-2-[(5-piperidin-4-yl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 126438872 |
| Molecular Formula | C18H29N5OS |
| Molecular Weight | 363.53 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | (2S)-N-cyclopentyl-2-[(5-piperidin-4-yl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propanamide |
| SMILES | C=CCn1c(S[C@@H](C)C(=O)NC2CCCC2)nnc1C1CCNCC1 |
| InChI | InChI=1S/C18H29N5OS/c1-3-12-23-16(14-8-10-19-11-9-14)21-22-18(23)25-13(2)17(24)20-15-6-4-5-7-15/h3,13-15,19H,1,4-12H2,2H3,(H,20,24)/t13-/m0/s1 |
| InChIKey | SOPUHUBBCGQSGP-ZDUSSCGKSA-N |
| XLogP | 2.47 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.53 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|