C18H28N4O3S2 — CID 40701987
(2S)-2-[(5-cyclohexyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-N-[(3R)-1,1-dioxothiolan-3-yl]propanamide (PubChem CID 40701987) has the molecular formula C18H28N4O3S2 and a molecular weight of 412.58 g/mol. Its IUPAC name is (2S)-2-[(5-cyclohexyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-N-[(3R)-1,1-dioxothiolan-3-yl]propanamide.
| Compound Name | (2S)-2-[(5-cyclohexyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-N-[(3R)-1,1-dioxothiolan-3-yl]propanamide |
|---|---|
| PubChem CID | 40701987 |
| Molecular Formula | C18H28N4O3S2 |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | (2S)-2-[(5-cyclohexyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-N-[(3R)-1,1-dioxothiolan-3-yl]propanamide |
| SMILES | C=CCn1c(S[C@@H](C)C(=O)N[C@@H]2CCS(=O)(=O)C2)nnc1C1CCCCC1 |
| InChI | InChI=1S/C18H28N4O3S2/c1-3-10-22-16(14-7-5-4-6-8-14)20-21-18(22)26-13(2)17(23)19-15-9-11-27(24,25)12-15/h3,13-15H,1,4-12H2,2H3,(H,19,23)/t13-,15+/m0/s1 |
| InChIKey | ROTZKZHOIYFCTB-DZGCQCFKSA-N |
| XLogP | 2.30 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|