C19H21N5O3S2 — CID 25491614
(2S)-N-(3-cyanophenyl)-2-[[5-[(3S)-1,1-dioxothiolan-3-yl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanamide (PubChem CID 25491614) has the molecular formula C19H21N5O3S2 and a molecular weight of 431.54 g/mol. Its IUPAC name is (2S)-N-(3-cyanophenyl)-2-[[5-[(3S)-1,1-dioxothiolan-3-yl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanamide.
| Compound Name | (2S)-N-(3-cyanophenyl)-2-[[5-[(3S)-1,1-dioxothiolan-3-yl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 25491614 |
| Molecular Formula | C19H21N5O3S2 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | (2S)-N-(3-cyanophenyl)-2-[[5-[(3S)-1,1-dioxothiolan-3-yl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanamide |
| SMILES | C=CCn1c(S[C@@H](C)C(=O)Nc2cccc(C#N)c2)nnc1[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H21N5O3S2/c1-3-8-24-17(15-7-9-29(26,27)12-15)22-23-19(24)28-13(2)18(25)21-16-6-4-5-14(10-16)11-20/h3-6,10,13,15H,1,7-9,12H2,2H3,(H,21,25)/t13-,15+/m0/s1 |
| InChIKey | NACFNLMHPRGTRK-DZGCQCFKSA-N |
| XLogP | 2.36 |
| TPSA | 117.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|