C19H23BrN4O3S2 — CID 24558706
N-(2-bromo-4-methylphenyl)-2-[[5-(1,1-dioxothiolan-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanamide (PubChem CID 24558706) has the molecular formula C19H23BrN4O3S2 and a molecular weight of 499.46 g/mol. Its IUPAC name is N-(2-bromo-4-methylphenyl)-2-[[5-(1,1-dioxothiolan-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanamide.
| Compound Name | N-(2-bromo-4-methylphenyl)-2-[[5-(1,1-dioxothiolan-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 24558706 |
| Molecular Formula | C19H23BrN4O3S2 |
| Molecular Weight | 499.46 g/mol |
| Exact Mass | 498.04 |
| IUPAC Name | N-(2-bromo-4-methylphenyl)-2-[[5-(1,1-dioxothiolan-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanamide |
| SMILES | C=CCn1c(SC(C)C(=O)Nc2ccc(C)cc2Br)nnc1C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H23BrN4O3S2/c1-4-8-24-17(14-7-9-29(26,27)11-14)22-23-19(24)28-13(3)18(25)21-16-6-5-12(2)10-15(16)20/h4-6,10,13-14H,1,7-9,11H2,2-3H3,(H,21,25) |
| InChIKey | BFHAUCGINKQHTF-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.46 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|