C19H23N5O4S2 — CID 45354810
4-[2-[[5-(1,1-dioxothiolan-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanoylamino]benzamide (PubChem CID 45354810) has the molecular formula C19H23N5O4S2 and a molecular weight of 449.56 g/mol. Its IUPAC name is 4-[2-[[5-(1,1-dioxothiolan-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanoylamino]benzamide.
| Compound Name | 4-[2-[[5-(1,1-dioxothiolan-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanoylamino]benzamide |
|---|---|
| PubChem CID | 45354810 |
| Molecular Formula | C19H23N5O4S2 |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | 4-[2-[[5-(1,1-dioxothiolan-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanoylamino]benzamide |
| SMILES | C=CCn1c(SC(C)C(=O)Nc2ccc(C(N)=O)cc2)nnc1C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H23N5O4S2/c1-3-9-24-17(14-8-10-30(27,28)11-14)22-23-19(24)29-12(2)18(26)21-15-6-4-13(5-7-15)16(20)25/h3-7,12,14H,1,8-11H2,2H3,(H2,20,25)(H,21,26) |
| InChIKey | VZIBPJLTESCTLI-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 137.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|