C17H21N5O5S3 — CID 43018132
2-[[5-(1,1-dioxothiolan-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-sulfamoylphenyl)acetamide (PubChem CID 43018132) has the molecular formula C17H21N5O5S3 and a molecular weight of 471.59 g/mol. Its IUPAC name is 2-[[5-(1,1-dioxothiolan-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-[[5-(1,1-dioxothiolan-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 43018132 |
| Molecular Formula | C17H21N5O5S3 |
| Molecular Weight | 471.59 g/mol |
| Exact Mass | 471.07 |
| IUPAC Name | 2-[[5-(1,1-dioxothiolan-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-sulfamoylphenyl)acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2ccc(S(N)(=O)=O)cc2)nnc1C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H21N5O5S3/c1-2-8-22-16(12-7-9-29(24,25)11-12)20-21-17(22)28-10-15(23)19-13-3-5-14(6-4-13)30(18,26)27/h2-6,12H,1,7-11H2,(H,19,23)(H2,18,26,27) |
| InChIKey | JAGRADXTJLMKAK-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 154.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.59 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|