C23H26N4O3S2 — CID 24558661
2-[[5-(1,1-dioxothiolan-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(1-naphthalen-1-ylethyl)acetamide (PubChem CID 24558661) has the molecular formula C23H26N4O3S2 and a molecular weight of 470.62 g/mol. Its IUPAC name is 2-[[5-(1,1-dioxothiolan-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(1-naphthalen-1-ylethyl)acetamide.
| Compound Name | 2-[[5-(1,1-dioxothiolan-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(1-naphthalen-1-ylethyl)acetamide |
|---|---|
| PubChem CID | 24558661 |
| Molecular Formula | C23H26N4O3S2 |
| Molecular Weight | 470.62 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | 2-[[5-(1,1-dioxothiolan-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(1-naphthalen-1-ylethyl)acetamide |
| SMILES | C=CCn1c(SCC(=O)NC(C)c2cccc3ccccc23)nnc1C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C23H26N4O3S2/c1-3-12-27-22(18-11-13-32(29,30)15-18)25-26-23(27)31-14-21(28)24-16(2)19-10-6-8-17-7-4-5-9-20(17)19/h3-10,16,18H,1,11-15H2,2H3,(H,24,28) |
| InChIKey | IPUQEMONDSSPSB-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.62 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|