C16H18ClN5O3S2 — CID 24599185
N-(5-chloro-2-pyridinyl)-2-[[5-(1,1-dioxothiolan-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 24599185) has the molecular formula C16H18ClN5O3S2 and a molecular weight of 427.94 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-2-[[5-(1,1-dioxothiolan-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-2-[[5-(1,1-dioxothiolan-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 24599185 |
| Molecular Formula | C16H18ClN5O3S2 |
| Molecular Weight | 427.94 g/mol |
| Exact Mass | 427.05 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-2-[[5-(1,1-dioxothiolan-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2ccc(Cl)cn2)nnc1C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H18ClN5O3S2/c1-2-6-22-15(11-5-7-27(24,25)10-11)20-21-16(22)26-9-14(23)19-13-4-3-12(17)8-18-13/h2-4,8,11H,1,5-7,9-10H2,(H,18,19,23) |
| InChIKey | OSBYJFJITGDVEN-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.94 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|