C17H18F2N4O3S2 — CID 45352925
N-(2,4-difluorophenyl)-2-[[5-(1,1-dioxothiolan-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 45352925) has the molecular formula C17H18F2N4O3S2 and a molecular weight of 428.49 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-2-[[5-(1,1-dioxothiolan-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-(2,4-difluorophenyl)-2-[[5-(1,1-dioxothiolan-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 45352925 |
| Molecular Formula | C17H18F2N4O3S2 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | N-(2,4-difluorophenyl)-2-[[5-(1,1-dioxothiolan-3-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2ccc(F)cc2F)nnc1C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H18F2N4O3S2/c1-2-6-23-16(11-5-7-28(25,26)10-11)21-22-17(23)27-9-15(24)20-14-4-3-12(18)8-13(14)19/h2-4,8,11H,1,5-7,9-10H2,(H,20,24) |
| InChIKey | PGQCILDROCGEKO-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|