C23H30N4OS — CID 40701991
(2S)-2-[(5-cyclohexyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2,3-dihydro-1H-inden-5-yl)propanamide (PubChem CID 40701991) has the molecular formula C23H30N4OS and a molecular weight of 410.59 g/mol. Its IUPAC name is (2S)-2-[(5-cyclohexyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2,3-dihydro-1H-inden-5-yl)propanamide.
| Compound Name | (2S)-2-[(5-cyclohexyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2,3-dihydro-1H-inden-5-yl)propanamide |
|---|---|
| PubChem CID | 40701991 |
| Molecular Formula | C23H30N4OS |
| Molecular Weight | 410.59 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | (2S)-2-[(5-cyclohexyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-N-(2,3-dihydro-1H-inden-5-yl)propanamide |
| SMILES | C=CCn1c(S[C@@H](C)C(=O)Nc2ccc3c(c2)CCC3)nnc1C1CCCCC1 |
| InChI | InChI=1S/C23H30N4OS/c1-3-14-27-21(18-8-5-4-6-9-18)25-26-23(27)29-16(2)22(28)24-20-13-12-17-10-7-11-19(17)15-20/h3,12-13,15-16,18H,1,4-11,14H2,2H3,(H,24,28)/t16-/m0/s1 |
| InChIKey | KDQLKXRVQMQYOF-INIZCTEOSA-N |
| XLogP | 5.12 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.59 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|