C22H27N3OS — CID 16502674
2-[(5-cyclohexyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-1-(2,3-dihydro-1H-inden-5-yl)ethanone (PubChem CID 16502674) has the molecular formula C22H27N3OS and a molecular weight of 381.55 g/mol. Its IUPAC name is 2-[(5-cyclohexyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-1-(2,3-dihydro-1H-inden-5-yl)ethanone.
| Compound Name | 2-[(5-cyclohexyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-1-(2,3-dihydro-1H-inden-5-yl)ethanone |
|---|---|
| PubChem CID | 16502674 |
| Molecular Formula | C22H27N3OS |
| Molecular Weight | 381.55 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 2-[(5-cyclohexyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-1-(2,3-dihydro-1H-inden-5-yl)ethanone |
| SMILES | C=CCn1c(SCC(=O)c2ccc3c(c2)CCC3)nnc1C1CCCCC1 |
| InChI | InChI=1S/C22H27N3OS/c1-2-13-25-21(17-7-4-3-5-8-17)23-24-22(25)27-15-20(26)19-12-11-16-9-6-10-18(16)14-19/h2,11-12,14,17H,1,3-10,13,15H2 |
| InChIKey | DHDGGADCWJXMOL-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.55 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|