C21H24N4O2S — CID 8023202
5-[2-[(5-cyclohexyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]-1,3-dihydroindol-2-one (PubChem CID 8023202) has the molecular formula C21H24N4O2S and a molecular weight of 396.52 g/mol. Its IUPAC name is 5-[2-[(5-cyclohexyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]-1,3-dihydroindol-2-one.
| Compound Name | 5-[2-[(5-cyclohexyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 8023202 |
| Molecular Formula | C21H24N4O2S |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 5-[2-[(5-cyclohexyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]-1,3-dihydroindol-2-one |
| SMILES | C=CCn1c(SCC(=O)c2ccc3c(c2)CC(=O)N3)nnc1C1CCCCC1 |
| InChI | InChI=1S/C21H24N4O2S/c1-2-10-25-20(14-6-4-3-5-7-14)23-24-21(25)28-13-18(26)15-8-9-17-16(11-15)12-19(27)22-17/h2,8-9,11,14H,1,3-7,10,12-13H2,(H,22,27) |
| InChIKey | YZZKARIPWOCAII-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|