C20H23N5O3S — CID 39537580
3-[3-cyclopropyl-5-[2-oxo-2-(2-oxo-1,3,4,5-tetrahydro-1-benzazepin-7-yl)ethyl]sulfanyl-1,2,4-triazol-4-yl]propanamide (PubChem CID 39537580) has the molecular formula C20H23N5O3S and a molecular weight of 413.50 g/mol. Its IUPAC name is 3-[3-cyclopropyl-5-[2-oxo-2-(2-oxo-1,3,4,5-tetrahydro-1-benzazepin-7-yl)ethyl]sulfanyl-1,2,4-triazol-4-yl]propanamide.
| Compound Name | 3-[3-cyclopropyl-5-[2-oxo-2-(2-oxo-1,3,4,5-tetrahydro-1-benzazepin-7-yl)ethyl]sulfanyl-1,2,4-triazol-4-yl]propanamide |
|---|---|
| PubChem CID | 39537580 |
| Molecular Formula | C20H23N5O3S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 3-[3-cyclopropyl-5-[2-oxo-2-(2-oxo-1,3,4,5-tetrahydro-1-benzazepin-7-yl)ethyl]sulfanyl-1,2,4-triazol-4-yl]propanamide |
| SMILES | NC(=O)CCn1c(SCC(=O)c2ccc3c(c2)CCCC(=O)N3)nnc1C1CC1 |
| InChI | InChI=1S/C20H23N5O3S/c21-17(27)8-9-25-19(12-4-5-12)23-24-20(25)29-11-16(26)14-6-7-15-13(10-14)2-1-3-18(28)22-15/h6-7,10,12H,1-5,8-9,11H2,(H2,21,27)(H,22,28) |
| InChIKey | XCYAKLRKPMKUSE-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |