C27H24N4O3S — CID 39532723
7-[2-[[5-(3-methoxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]-1,3,4,5-tetrahydro-1-benzazepin-2-one (PubChem CID 39532723) has the molecular formula C27H24N4O3S and a molecular weight of 484.58 g/mol. Its IUPAC name is 7-[2-[[5-(3-methoxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]-1,3,4,5-tetrahydro-1-benzazepin-2-one.
| Compound Name | 7-[2-[[5-(3-methoxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]-1,3,4,5-tetrahydro-1-benzazepin-2-one |
|---|---|
| PubChem CID | 39532723 |
| Molecular Formula | C27H24N4O3S |
| Molecular Weight | 484.58 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | 7-[2-[[5-(3-methoxyphenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]-1,3,4,5-tetrahydro-1-benzazepin-2-one |
| SMILES | COc1cccc(-c2nnc(SCC(=O)c3ccc4c(c3)CCCC(=O)N4)n2-c2ccccc2)c1 |
| InChI | InChI=1S/C27H24N4O3S/c1-34-22-11-5-8-20(16-22)26-29-30-27(31(26)21-9-3-2-4-10-21)35-17-24(32)19-13-14-23-18(15-19)7-6-12-25(33)28-23/h2-5,8-11,13-16H,6-7,12,17H2,1H3,(H,28,33) |
| InChIKey | DGJUCTKBUAEZME-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.58 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |