C25H19FN4O3S — CID 55517170
(2-oxo-3,4-dihydro-1H-quinolin-6-yl) 2-[[5-(4-fluorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetate (PubChem CID 55517170) has the molecular formula C25H19FN4O3S and a molecular weight of 474.52 g/mol. Its IUPAC name is (2-oxo-3,4-dihydro-1H-quinolin-6-yl) 2-[[5-(4-fluorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetate.
| Compound Name | (2-oxo-3,4-dihydro-1H-quinolin-6-yl) 2-[[5-(4-fluorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 55517170 |
| Molecular Formula | C25H19FN4O3S |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | (2-oxo-3,4-dihydro-1H-quinolin-6-yl) 2-[[5-(4-fluorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetate |
| SMILES | O=C1CCc2cc(OC(=O)CSc3nnc(-c4ccc(F)cc4)n3-c3ccccc3)ccc2N1 |
| InChI | InChI=1S/C25H19FN4O3S/c26-18-9-6-16(7-10-18)24-28-29-25(30(24)19-4-2-1-3-5-19)34-15-23(32)33-20-11-12-21-17(14-20)8-13-22(31)27-21/h1-7,9-12,14H,8,13,15H2,(H,27,31) |
| InChIKey | CWLDUPLGPAMZSZ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|