C27H20N4O2S — CID 16552042
(4-phenylphenyl) 2-[(4-phenyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]acetate (PubChem CID 16552042) has the molecular formula C27H20N4O2S and a molecular weight of 464.55 g/mol. Its IUPAC name is (4-phenylphenyl) 2-[(4-phenyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]acetate.
| Compound Name | (4-phenylphenyl) 2-[(4-phenyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]acetate |
|---|---|
| PubChem CID | 16552042 |
| Molecular Formula | C27H20N4O2S |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | (4-phenylphenyl) 2-[(4-phenyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]acetate |
| SMILES | O=C(CSc1nnc(-c2cccnc2)n1-c1ccccc1)Oc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C27H20N4O2S/c32-25(33-24-15-13-21(14-16-24)20-8-3-1-4-9-20)19-34-27-30-29-26(22-10-7-17-28-18-22)31(27)23-11-5-2-6-12-23/h1-18H,19H2 |
| InChIKey | BDXSJHHBOPRHBO-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|