C22H17ClN4O2S — CID 16546253
(4-chloro-2-methylphenyl) 2-[(4-phenyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]acetate (PubChem CID 16546253) has the molecular formula C22H17ClN4O2S and a molecular weight of 436.92 g/mol. Its IUPAC name is (4-chloro-2-methylphenyl) 2-[(4-phenyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]acetate.
| Compound Name | (4-chloro-2-methylphenyl) 2-[(4-phenyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]acetate |
|---|---|
| PubChem CID | 16546253 |
| Molecular Formula | C22H17ClN4O2S |
| Molecular Weight | 436.92 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | (4-chloro-2-methylphenyl) 2-[(4-phenyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]acetate |
| SMILES | Cc1cc(Cl)ccc1OC(=O)CSc1nnc(-c2cccnc2)n1-c1ccccc1 |
| InChI | InChI=1S/C22H17ClN4O2S/c1-15-12-17(23)9-10-19(15)29-20(28)14-30-22-26-25-21(16-6-5-11-24-13-16)27(22)18-7-3-2-4-8-18/h2-13H,14H2,1H3 |
| InChIKey | FBFQSIXICZJCKP-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.92 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|