C26H26N6O2S — CID 2999569
1-[4-(4-methoxyphenyl)piperazin-1-yl]-2-[(4-phenyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]ethanone (PubChem CID 2999569) has the molecular formula C26H26N6O2S and a molecular weight of 486.60 g/mol. Its IUPAC name is 1-[4-(4-methoxyphenyl)piperazin-1-yl]-2-[(4-phenyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]ethanone.
| Compound Name | 1-[4-(4-methoxyphenyl)piperazin-1-yl]-2-[(4-phenyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]ethanone |
|---|---|
| PubChem CID | 2999569 |
| Molecular Formula | C26H26N6O2S |
| Molecular Weight | 486.60 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | 1-[4-(4-methoxyphenyl)piperazin-1-yl]-2-[(4-phenyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]ethanone |
| SMILES | COc1ccc(N2CCN(C(=O)CSc3nnc(-c4cccnc4)n3-c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C26H26N6O2S/c1-34-23-11-9-21(10-12-23)30-14-16-31(17-15-30)24(33)19-35-26-29-28-25(20-6-5-13-27-18-20)32(26)22-7-3-2-4-8-22/h2-13,18H,14-17,19H2,1H3 |
| InChIKey | UFTMMFMDMLWONB-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 76.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.60 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|