C36H32N8O2S2 — CID 124598443
2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-1-[4-[2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]piperazin-1-yl]ethanone (PubChem CID 124598443) has the molecular formula C36H32N8O2S2 and a molecular weight of 672.84 g/mol. Its IUPAC name is 2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-1-[4-[2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]piperazin-1-yl]ethanone.
| Compound Name | 2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-1-[4-[2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 124598443 |
| Molecular Formula | C36H32N8O2S2 |
| Molecular Weight | 672.84 g/mol |
| Exact Mass | 672.21 |
| IUPAC Name | 2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-1-[4-[2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]piperazin-1-yl]ethanone |
| SMILES | O=C(CSc1nnc(-c2ccccc2)n1-c1ccccc1)N1CCN(C(=O)CSc2nnc(-c3ccccc3)n2-c2ccccc2)CC1 |
| InChI | InChI=1S/C36H32N8O2S2/c45-31(25-47-35-39-37-33(27-13-5-1-6-14-27)43(35)29-17-9-3-10-18-29)41-21-23-42(24-22-41)32(46)26-48-36-40-38-34(28-15-7-2-8-16-28)44(36)30-19-11-4-12-20-30/h1-20H,21-26H2 |
| InChIKey | PALCYMLDJAKORJ-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 102.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.84 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |