C22H24N4OS — CID 2706954
1-(azepan-1-yl)-2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]ethanone (PubChem CID 2706954) has the molecular formula C22H24N4OS and a molecular weight of 392.53 g/mol. Its IUPAC name is 1-(azepan-1-yl)-2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]ethanone.
| Compound Name | 1-(azepan-1-yl)-2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]ethanone |
|---|---|
| PubChem CID | 2706954 |
| Molecular Formula | C22H24N4OS |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 1-(azepan-1-yl)-2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]ethanone |
| SMILES | O=C(CSc1nnc(-c2ccccc2)n1-c1ccccc1)N1CCCCCC1 |
| InChI | InChI=1S/C22H24N4OS/c27-20(25-15-9-1-2-10-16-25)17-28-22-24-23-21(18-11-5-3-6-12-18)26(22)19-13-7-4-8-14-19/h3-8,11-14H,1-2,9-10,15-17H2 |
| InChIKey | AJIQGJHNNREHCA-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |