C26H24N6O3S — CID 2940953
2-[[5-(4-nitrophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-1-(4-phenylpiperazin-1-yl)ethanone (PubChem CID 2940953) has the molecular formula C26H24N6O3S and a molecular weight of 500.58 g/mol. Its IUPAC name is 2-[[5-(4-nitrophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-1-(4-phenylpiperazin-1-yl)ethanone.
| Compound Name | 2-[[5-(4-nitrophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-1-(4-phenylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 2940953 |
| Molecular Formula | C26H24N6O3S |
| Molecular Weight | 500.58 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | 2-[[5-(4-nitrophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-1-(4-phenylpiperazin-1-yl)ethanone |
| SMILES | O=C(CSc1nnc(-c2ccc([N+](=O)[O-])cc2)n1-c1ccccc1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C26H24N6O3S/c33-24(30-17-15-29(16-18-30)21-7-3-1-4-8-21)19-36-26-28-27-25(31(26)22-9-5-2-6-10-22)20-11-13-23(14-12-20)32(34)35/h1-14H,15-19H2 |
| InChIKey | NPZHVEBXTWDUTC-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 97.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.58 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|