C23H25N5O4S — CID 42742359
1-morpholin-4-yl-5-[[5-(4-nitrophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]pentan-1-one (PubChem CID 42742359) has the molecular formula C23H25N5O4S and a molecular weight of 467.55 g/mol. Its IUPAC name is 1-morpholin-4-yl-5-[[5-(4-nitrophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]pentan-1-one.
| Compound Name | 1-morpholin-4-yl-5-[[5-(4-nitrophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]pentan-1-one |
|---|---|
| PubChem CID | 42742359 |
| Molecular Formula | C23H25N5O4S |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | 1-morpholin-4-yl-5-[[5-(4-nitrophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]pentan-1-one |
| SMILES | O=C(CCCCSc1nnc(-c2ccc([N+](=O)[O-])cc2)n1-c1ccccc1)N1CCOCC1 |
| InChI | InChI=1S/C23H25N5O4S/c29-21(26-13-15-32-16-14-26)8-4-5-17-33-23-25-24-22(27(23)19-6-2-1-3-7-19)18-9-11-20(12-10-18)28(30)31/h1-3,6-7,9-12H,4-5,8,13-17H2 |
| InChIKey | FGLYPLKYQGGBFA-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 103.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|