C25H31N5O3S — CID 42742379
N-hexyl-5-[[5-(4-nitrophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]pentanamide (PubChem CID 42742379) has the molecular formula C25H31N5O3S and a molecular weight of 481.62 g/mol. Its IUPAC name is N-hexyl-5-[[5-(4-nitrophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]pentanamide.
| Compound Name | N-hexyl-5-[[5-(4-nitrophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]pentanamide |
|---|---|
| PubChem CID | 42742379 |
| Molecular Formula | C25H31N5O3S |
| Molecular Weight | 481.62 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | N-hexyl-5-[[5-(4-nitrophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]pentanamide |
| SMILES | CCCCCCNC(=O)CCCCSc1nnc(-c2ccc([N+](=O)[O-])cc2)n1-c1ccccc1 |
| InChI | InChI=1S/C25H31N5O3S/c1-2-3-4-9-18-26-23(31)13-8-10-19-34-25-28-27-24(29(25)21-11-6-5-7-12-21)20-14-16-22(17-15-20)30(32)33/h5-7,11-12,14-17H,2-4,8-10,13,18-19H2,1H3,(H,26,31) |
| InChIKey | WMKBDESMVJFGEH-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.62 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|