C33H31N5O3S — CID 3996076
N-(1,2-diphenylethyl)-5-[[5-(4-nitrophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]pentanamide (PubChem CID 3996076) has the molecular formula C33H31N5O3S and a molecular weight of 577.71 g/mol. Its IUPAC name is N-(1,2-diphenylethyl)-5-[[5-(4-nitrophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]pentanamide.
| Compound Name | N-(1,2-diphenylethyl)-5-[[5-(4-nitrophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]pentanamide |
|---|---|
| PubChem CID | 3996076 |
| Molecular Formula | C33H31N5O3S |
| Molecular Weight | 577.71 g/mol |
| Exact Mass | 577.21 |
| IUPAC Name | N-(1,2-diphenylethyl)-5-[[5-(4-nitrophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]pentanamide |
| SMILES | O=C(CCCCSc1nnc(-c2ccc([N+](=O)[O-])cc2)n1-c1ccccc1)NC(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H31N5O3S/c39-31(34-30(26-14-6-2-7-15-26)24-25-12-4-1-5-13-25)18-10-11-23-42-33-36-35-32(37(33)28-16-8-3-9-17-28)27-19-21-29(22-20-27)38(40)41/h1-9,12-17,19-22,30H,10-11,18,23-24H2,(H,34,39) |
| InChIKey | ORFHKBKWOGBMQH-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.71 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|