C34H34N4OS — CID 3992461
N-(1,2-diphenylethyl)-4-[[4-(2-methylphenyl)-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]butanamide (PubChem CID 3992461) has the molecular formula C34H34N4OS and a molecular weight of 546.74 g/mol. Its IUPAC name is N-(1,2-diphenylethyl)-4-[[4-(2-methylphenyl)-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]butanamide.
| Compound Name | N-(1,2-diphenylethyl)-4-[[4-(2-methylphenyl)-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]butanamide |
|---|---|
| PubChem CID | 3992461 |
| Molecular Formula | C34H34N4OS |
| Molecular Weight | 546.74 g/mol |
| Exact Mass | 546.25 |
| IUPAC Name | N-(1,2-diphenylethyl)-4-[[4-(2-methylphenyl)-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]butanamide |
| SMILES | Cc1ccc(-c2nnc(SCCCC(=O)NC(Cc3ccccc3)c3ccccc3)n2-c2ccccc2C)cc1 |
| InChI | InChI=1S/C34H34N4OS/c1-25-19-21-29(22-20-25)33-36-37-34(38(33)31-17-10-9-12-26(31)2)40-23-11-18-32(39)35-30(28-15-7-4-8-16-28)24-27-13-5-3-6-14-27/h3-10,12-17,19-22,30H,11,18,23-24H2,1-2H3,(H,35,39) |
| InChIKey | OPXXIHXDMAGDDL-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.74 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|