C32H29ClN4OS — CID 98420115
4-[[5-(2-chlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(1S)-1,2-diphenylethyl]butanamide (PubChem CID 98420115) has the molecular formula C32H29ClN4OS and a molecular weight of 553.13 g/mol. Its IUPAC name is 4-[[5-(2-chlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(1S)-1,2-diphenylethyl]butanamide.
| Compound Name | 4-[[5-(2-chlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(1S)-1,2-diphenylethyl]butanamide |
|---|---|
| PubChem CID | 98420115 |
| Molecular Formula | C32H29ClN4OS |
| Molecular Weight | 553.13 g/mol |
| Exact Mass | 552.18 |
| IUPAC Name | 4-[[5-(2-chlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(1S)-1,2-diphenylethyl]butanamide |
| SMILES | O=C(CCCSc1nnc(-c2ccccc2Cl)n1-c1ccccc1)N[C@@H](Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H29ClN4OS/c33-28-20-11-10-19-27(28)31-35-36-32(37(31)26-17-8-3-9-18-26)39-22-12-21-30(38)34-29(25-15-6-2-7-16-25)23-24-13-4-1-5-14-24/h1-11,13-20,29H,12,21-23H2,(H,34,38)/t29-/m0/s1 |
| InChIKey | MFJIYCDAZMMJFG-LJAQVGFWSA-N |
| XLogP | 7.56 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.13 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|