C24H22ClN5OS — CID 5104238
4-[[5-(2-chlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(pyridin-4-ylmethyl)butanamide (PubChem CID 5104238) has the molecular formula C24H22ClN5OS and a molecular weight of 463.99 g/mol. Its IUPAC name is 4-[[5-(2-chlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(pyridin-4-ylmethyl)butanamide.
| Compound Name | 4-[[5-(2-chlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(pyridin-4-ylmethyl)butanamide |
|---|---|
| PubChem CID | 5104238 |
| Molecular Formula | C24H22ClN5OS |
| Molecular Weight | 463.99 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | 4-[[5-(2-chlorophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-(pyridin-4-ylmethyl)butanamide |
| SMILES | O=C(CCCSc1nnc(-c2ccccc2Cl)n1-c1ccccc1)NCc1ccncc1 |
| InChI | InChI=1S/C24H22ClN5OS/c25-21-10-5-4-9-20(21)23-28-29-24(30(23)19-7-2-1-3-8-19)32-16-6-11-22(31)27-17-18-12-14-26-15-13-18/h1-5,7-10,12-15H,6,11,16-17H2,(H,27,31) |
| InChIKey | NFFZQIFNLYVDFB-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.99 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|